C17H17N3OS — CID 10733824
2-[(3-methyl-4-prop-2-enoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole (PubChem CID 10733824) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[(3-methyl-4-prop-2-enoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[(3-methyl-4-prop-2-enoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 10733824 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[(3-methyl-4-prop-2-enoxy-2-pyridinyl)methylsulfanyl]-1H-benzimidazole |
| SMILES | C=CCOc1ccnc(CSc2nc3ccccc3[nH]2)c1C |
| InChI | InChI=1S/C17H17N3OS/c1-3-10-21-16-8-9-18-15(12(16)2)11-22-17-19-13-6-4-5-7-14(13)20-17/h3-9H,1,10-11H2,2H3,(H,19,20) |
| InChIKey | OWHUGHCTUQUKOX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|