C28H27N7OS — CID 176993216
N,N'-diamino-3-[4-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxymethyl]phenyl]benzenecarboximidamide (PubChem CID 176993216) has the molecular formula C28H27N7OS and a molecular weight of 509.64 g/mol. Its IUPAC name is N,N'-diamino-3-[4-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxymethyl]phenyl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-3-[4-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxymethyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 176993216 |
| Molecular Formula | C28H27N7OS |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N,N'-diamino-3-[4-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxymethyl]phenyl]benzenecarboximidamide |
| SMILES | Cc1c(OCc2ccc(-c3cccc(/C(=N/N)NN)c3)cc2)ccnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H27N7OS/c1-18-25(17-37-28-32-23-7-2-3-8-24(23)33-28)31-14-13-26(18)36-16-19-9-11-20(12-10-19)21-5-4-6-22(15-21)27(34-29)35-30/h2-15H,16-17,29-30H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | NBNBIIKAGQEUSZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|