C22H28N4O3S — CID 175195153
3-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxy]propoxy]-3-methylbutanamide (PubChem CID 175195153) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxy]propoxy]-3-methylbutanamide.
| Compound Name | 3-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxy]propoxy]-3-methylbutanamide |
|---|---|
| PubChem CID | 175195153 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]oxy]propoxy]-3-methylbutanamide |
| SMILES | Cc1c(OCCCOC(C)(C)CC(N)=O)ccnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H28N4O3S/c1-15-18(14-30-21-25-16-7-4-5-8-17(16)26-21)24-10-9-19(15)28-11-6-12-29-22(2,3)13-20(23)27/h4-5,7-10H,6,11-14H2,1-3H3,(H2,23,27)(H,25,26) |
| InChIKey | FPTJDGDVTOBIRE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|