C17H20Cl3N3OS2 — CID 70197194
2-[[4-(3-chloropropylsulfanyl)-3-methoxy-2-pyridinyl]methylsulfanyl]-1H-benzimidazole;dihydrochloride (PubChem CID 70197194) has the molecular formula C17H20Cl3N3OS2 and a molecular weight of 452.86 g/mol. Its IUPAC name is 2-[[4-(3-chloropropylsulfanyl)-3-methoxy-2-pyridinyl]methylsulfanyl]-1H-benzimidazole;dihydrochloride.
| Compound Name | 2-[[4-(3-chloropropylsulfanyl)-3-methoxy-2-pyridinyl]methylsulfanyl]-1H-benzimidazole;dihydrochloride |
|---|---|
| PubChem CID | 70197194 |
| Molecular Formula | C17H20Cl3N3OS2 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2-[[4-(3-chloropropylsulfanyl)-3-methoxy-2-pyridinyl]methylsulfanyl]-1H-benzimidazole;dihydrochloride |
| SMILES | COc1c(SCCCCl)ccnc1CSc1nc2ccccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C17H18ClN3OS2.2ClH/c1-22-16-14(19-9-7-15(16)23-10-4-8-18)11-24-17-20-12-5-2-3-6-13(12)21-17;;/h2-3,5-7,9H,4,8,10-11H2,1H3,(H,20,21);2*1H |
| InChIKey | PVLCXOMTRAKTKA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|