C16H19Cl3N4S2 — CID 67583920
2-[[4-(3-chloropropylsulfanyl)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-imidazo[4,5-b]pyridine;dihydrochloride (PubChem CID 67583920) has the molecular formula C16H19Cl3N4S2 and a molecular weight of 437.85 g/mol. Its IUPAC name is 2-[[4-(3-chloropropylsulfanyl)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-imidazo[4,5-b]pyridine;dihydrochloride.
| Compound Name | 2-[[4-(3-chloropropylsulfanyl)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-imidazo[4,5-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 67583920 |
| Molecular Formula | C16H19Cl3N4S2 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2-[[4-(3-chloropropylsulfanyl)-3-methyl-2-pyridinyl]methylsulfanyl]-1H-imidazo[4,5-b]pyridine;dihydrochloride |
| SMILES | Cc1c(SCCCCl)ccnc1CSc1nc2ncccc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C16H17ClN4S2.2ClH/c1-11-13(18-8-5-14(11)22-9-3-6-17)10-23-16-20-12-4-2-7-19-15(12)21-16;;/h2,4-5,7-8H,3,6,9-10H2,1H3,(H,19,20,21);2*1H |
| InChIKey | YXKHUFVHQAGOFY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|