C26H29N3OS2 — CID 54082493
6-methoxy-2-[[3-methyl-4-[4-(4-methylphenyl)butylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 54082493) has the molecular formula C26H29N3OS2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 6-methoxy-2-[[3-methyl-4-[4-(4-methylphenyl)butylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-methoxy-2-[[3-methyl-4-[4-(4-methylphenyl)butylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 54082493 |
| Molecular Formula | C26H29N3OS2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 6-methoxy-2-[[3-methyl-4-[4-(4-methylphenyl)butylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCc3nccc(SCCCCc4ccc(C)cc4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C26H29N3OS2/c1-18-7-9-20(10-8-18)6-4-5-15-31-25-13-14-27-24(19(25)2)17-32-26-28-22-12-11-21(30-3)16-23(22)29-26/h7-14,16H,4-6,15,17H2,1-3H3,(H,28,29) |
| InChIKey | MOBVUMIVZHGTDL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|