C25H27N3OS2 — CID 54467678
2-[[3-methoxy-4-(5-phenylpentylsulfanyl)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 54467678) has the molecular formula C25H27N3OS2 and a molecular weight of 449.65 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(5-phenylpentylsulfanyl)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[3-methoxy-4-(5-phenylpentylsulfanyl)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 54467678 |
| Molecular Formula | C25H27N3OS2 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[[3-methoxy-4-(5-phenylpentylsulfanyl)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | COc1c(SCCCCCc2ccccc2)ccnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H27N3OS2/c1-29-24-22(18-31-25-27-20-13-7-8-14-21(20)28-25)26-16-15-23(24)30-17-9-3-6-12-19-10-4-2-5-11-19/h2,4-5,7-8,10-11,13-16H,3,6,9,12,17-18H2,1H3,(H,27,28) |
| InChIKey | XGCDMSPNXKCNRX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|