C30H36N4O2S2 — CID 19963000
ethyl 4-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl-benzylamino]butanoate (PubChem CID 19963000) has the molecular formula C30H36N4O2S2 and a molecular weight of 548.78 g/mol. Its IUPAC name is ethyl 4-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl-benzylamino]butanoate.
| Compound Name | ethyl 4-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl-benzylamino]butanoate |
|---|---|
| PubChem CID | 19963000 |
| Molecular Formula | C30H36N4O2S2 |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | ethyl 4-[3-[[2-(1H-benzimidazol-2-ylsulfanylmethyl)-3-methyl-4-pyridinyl]sulfanyl]propyl-benzylamino]butanoate |
| SMILES | CCOC(=O)CCCN(CCCSc1ccnc(CSc2nc3ccccc3[nH]2)c1C)Cc1ccccc1 |
| InChI | InChI=1S/C30H36N4O2S2/c1-3-36-29(35)15-9-18-34(21-24-11-5-4-6-12-24)19-10-20-37-28-16-17-31-27(23(28)2)22-38-30-32-25-13-7-8-14-26(25)33-30/h4-8,11-14,16-17H,3,9-10,15,18-22H2,1-2H3,(H,32,33) |
| InChIKey | MXGXTQXABIZOQQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|