C27H31N3OS2 — CID 54370139
6-methoxy-2-[[3-methyl-4-[5-(4-methylphenyl)pentylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 54370139) has the molecular formula C27H31N3OS2 and a molecular weight of 477.70 g/mol. Its IUPAC name is 6-methoxy-2-[[3-methyl-4-[5-(4-methylphenyl)pentylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-methoxy-2-[[3-methyl-4-[5-(4-methylphenyl)pentylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 54370139 |
| Molecular Formula | C27H31N3OS2 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 6-methoxy-2-[[3-methyl-4-[5-(4-methylphenyl)pentylsulfanyl]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCc3nccc(SCCCCCc4ccc(C)cc4)c3C)[nH]c2c1 |
| InChI | InChI=1S/C27H31N3OS2/c1-19-8-10-21(11-9-19)7-5-4-6-16-32-26-14-15-28-25(20(26)2)18-33-27-29-23-13-12-22(31-3)17-24(23)30-27/h8-15,17H,4-7,16,18H2,1-3H3,(H,29,30) |
| InChIKey | USPKAJPFDOJFPS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|