C25H25F2N3O2S2 — CID 54300890
2-[[4-[4-(2,4-difluorophenyl)butylsulfanyl]-3-methoxy-2-pyridinyl]methylsulfanyl]-6-methoxy-1H-benzimidazole (PubChem CID 54300890) has the molecular formula C25H25F2N3O2S2 and a molecular weight of 501.62 g/mol. Its IUPAC name is 2-[[4-[4-(2,4-difluorophenyl)butylsulfanyl]-3-methoxy-2-pyridinyl]methylsulfanyl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[[4-[4-(2,4-difluorophenyl)butylsulfanyl]-3-methoxy-2-pyridinyl]methylsulfanyl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 54300890 |
| Molecular Formula | C25H25F2N3O2S2 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-[[4-[4-(2,4-difluorophenyl)butylsulfanyl]-3-methoxy-2-pyridinyl]methylsulfanyl]-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCc3nccc(SCCCCc4ccc(F)cc4F)c3OC)[nH]c2c1 |
| InChI | InChI=1S/C25H25F2N3O2S2/c1-31-18-8-9-20-21(14-18)30-25(29-20)34-15-22-24(32-2)23(10-11-28-22)33-12-4-3-5-16-6-7-17(26)13-19(16)27/h6-11,13-14H,3-5,12,15H2,1-2H3,(H,29,30) |
| InChIKey | SEBVUJMPLLXBGX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|