C7H6FN3S — CID 141354829
2-(fluoromethylsulfanyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 141354829) has the molecular formula C7H6FN3S and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-(fluoromethylsulfanyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(fluoromethylsulfanyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 141354829 |
| Molecular Formula | C7H6FN3S |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 2-(fluoromethylsulfanyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | FCSc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C7H6FN3S/c8-4-12-7-10-5-2-1-3-9-6(5)11-7/h1-3H,4H2,(H,9,10,11) |
| InChIKey | ZAWUSBASQOVMHK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |