C13H12ClN3O2 — CID 114213761
ethyl 4-chloro-2-(pyridin-2-ylmethyl)pyrimidine-5-carboxylate (PubChem CID 114213761) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is ethyl 4-chloro-2-(pyridin-2-ylmethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-chloro-2-(pyridin-2-ylmethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114213761 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | ethyl 4-chloro-2-(pyridin-2-ylmethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cc2ccccn2)nc1Cl |
| InChI | InChI=1S/C13H12ClN3O2/c1-2-19-13(18)10-8-16-11(17-12(10)14)7-9-5-3-4-6-15-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | MAYCPZLGDNVOOP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |