C13H12N4O2S2 — CID 79466724
2-amino-4-(1H-benzimidazol-2-ylsulfanyl)benzenesulfonamide (PubChem CID 79466724) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-amino-4-(1H-benzimidazol-2-ylsulfanyl)benzenesulfonamide.
| Compound Name | 2-amino-4-(1H-benzimidazol-2-ylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79466724 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-amino-4-(1H-benzimidazol-2-ylsulfanyl)benzenesulfonamide |
| SMILES | Nc1cc(Sc2nc3ccccc3[nH]2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H12N4O2S2/c14-9-7-8(5-6-12(9)21(15,18)19)20-13-16-10-3-1-2-4-11(10)17-13/h1-7H,14H2,(H,16,17)(H2,15,18,19) |
| InChIKey | XKYWPVDDIWXBLS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|