C14H12N2O2S — CID 139213863
5-(1H-benzimidazol-2-ylsulfanyl)-3-methylbenzene-1,2-diol (PubChem CID 139213863) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)-3-methylbenzene-1,2-diol.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 139213863 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)-3-methylbenzene-1,2-diol |
| SMILES | Cc1cc(Sc2nc3ccccc3[nH]2)cc(O)c1O |
| InChI | InChI=1S/C14H12N2O2S/c1-8-6-9(7-12(17)13(8)18)19-14-15-10-4-2-3-5-11(10)16-14/h2-7,17-18H,1H3,(H,15,16) |
| InChIKey | LVTUGHUJIKZXFR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|