About N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine
N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine (PubChem CID 139976897) has the molecular formula C10H11F2N7
and a molecular weight of 267.24 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine |
| PubChem CID | 139976897 |
| Molecular Formula | C10H11F2N7 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine |
| SMILES | NNc1cc(NN)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H11F2N7/c11-6-2-1-5(3-7(6)12)15-10-16-8(18-13)4-9(17-10)19-14/h1-4H,13-14H2,(H3,15,16,17,18,19) |
| InChIKey | JJFUMBQQENHQAN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine?
The IUPAC name of N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine (CID 139976897) is N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine.
What is the SMILES notation for N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine?
The canonical SMILES for N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine is NNc1cc(NN)nc(Nc2ccc(F)c(F)c2)n1.
What is the InChIKey of N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine?
The InChIKey is JJFUMBQQENHQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N7/c11-6-2-1-5(3-7(6)12)15-10-16-8(18-13)4-9(17-10)19-14/h1-4H,13-14H2,(H3,15,16,17,18,19).
What are the key properties of N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine?
N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine has a molecular weight of 267.24 g/mol, XLogP of 1.07, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine is sourced from PubChem (CID 139976897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).