C10H11F2N7 — CID 139976897
N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine (PubChem CID 139976897) has the molecular formula C10H11F2N7 and a molecular weight of 267.24 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine.
| Compound Name | N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine |
|---|---|
| PubChem CID | 139976897 |
| Molecular Formula | C10H11F2N7 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-4,6-dihydrazinylpyrimidin-2-amine |
| SMILES | NNc1cc(NN)nc(Nc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H11F2N7/c11-6-2-1-5(3-7(6)12)15-10-16-8(18-13)4-9(17-10)19-14/h1-4H,13-14H2,(H3,15,16,17,18,19) |
| InChIKey | JJFUMBQQENHQAN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|