C10H12ClN5O — CID 104697863
2-[(2-chloro-7H-purin-6-yl)-cyclopropylamino]ethanol (PubChem CID 104697863) has the molecular formula C10H12ClN5O and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-[(2-chloro-7H-purin-6-yl)-cyclopropylamino]ethanol.
| Compound Name | 2-[(2-chloro-7H-purin-6-yl)-cyclopropylamino]ethanol |
|---|---|
| PubChem CID | 104697863 |
| Molecular Formula | C10H12ClN5O |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-[(2-chloro-7H-purin-6-yl)-cyclopropylamino]ethanol |
| SMILES | OCCN(c1nc(Cl)nc2nc[nH]c12)C1CC1 |
| InChI | InChI=1S/C10H12ClN5O/c11-10-14-8-7(12-5-13-8)9(15-10)16(3-4-17)6-1-2-6/h5-6,17H,1-4H2,(H,12,13,14,15) |
| InChIKey | TVHYYHVMFWYDMK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |