C16H13N9O — CID 123422552
8-[6-[2-(furan-2-yl)ethyl]-7H-purin-2-yl]-7H-purin-6-amine (PubChem CID 123422552) has the molecular formula C16H13N9O and a molecular weight of 347.34 g/mol. Its IUPAC name is 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-2-yl]-7H-purin-6-amine.
| Compound Name | 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-2-yl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123422552 |
| Molecular Formula | C16H13N9O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 8-[6-[2-(furan-2-yl)ethyl]-7H-purin-2-yl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(-c3nc(CCc4ccco4)c4[nH]cnc4n3)[nH]c12 |
| InChI | InChI=1S/C16H13N9O/c17-12-11-14(21-7-19-12)25-16(23-11)15-22-9(4-3-8-2-1-5-26-8)10-13(24-15)20-6-18-10/h1-2,5-7H,3-4H2,(H,18,20,22,24)(H3,17,19,21,23,25) |
| InChIKey | XNKKQYZAGHUMIF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |