C11H21N5Si2 — CID 19910051
N,N-bis(trimethylsilyl)-7H-purin-6-amine (PubChem CID 19910051) has the molecular formula C11H21N5Si2 and a molecular weight of 279.50 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)-7H-purin-6-amine.
| Compound Name | N,N-bis(trimethylsilyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 19910051 |
| Molecular Formula | C11H21N5Si2 |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N,N-bis(trimethylsilyl)-7H-purin-6-amine |
| SMILES | C[Si](C)(C)N(c1ncnc2nc[nH]c12)[Si](C)(C)C |
| InChI | InChI=1S/C11H21N5Si2/c1-17(2,3)16(18(4,5)6)11-9-10(13-7-12-9)14-8-15-11/h7-8H,1-6H3,(H,12,13,14,15) |
| InChIKey | AUSXCQAZCCARJV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|