C16H16N4O — CID 110433912
2-[benzyl(pyrido[2,3-d]pyrimidin-4-yl)amino]ethanol (PubChem CID 110433912) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[benzyl(pyrido[2,3-d]pyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[benzyl(pyrido[2,3-d]pyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 110433912 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[benzyl(pyrido[2,3-d]pyrimidin-4-yl)amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1ncnc2ncccc12 |
| InChI | InChI=1S/C16H16N4O/c21-10-9-20(11-13-5-2-1-3-6-13)16-14-7-4-8-17-15(14)18-12-19-16/h1-8,12,21H,9-11H2 |
| InChIKey | GICFPRNEPYZCJR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |