C14H20N6O2S — CID 146524869
N-methyl-6-[methyl(7H-purin-6-yl)amino]spiro[3.3]heptane-2-sulfonamide (PubChem CID 146524869) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-methyl-6-[methyl(7H-purin-6-yl)amino]spiro[3.3]heptane-2-sulfonamide.
| Compound Name | N-methyl-6-[methyl(7H-purin-6-yl)amino]spiro[3.3]heptane-2-sulfonamide |
|---|---|
| PubChem CID | 146524869 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-methyl-6-[methyl(7H-purin-6-yl)amino]spiro[3.3]heptane-2-sulfonamide |
| SMILES | CNS(=O)(=O)C1CC2(CC(N(C)c3ncnc4nc[nH]c34)C2)C1 |
| InChI | InChI=1S/C14H20N6O2S/c1-15-23(21,22)10-5-14(6-10)3-9(4-14)20(2)13-11-12(17-7-16-11)18-8-19-13/h7-10,15H,3-6H2,1-2H3,(H,16,17,18,19) |
| InChIKey | JHJUJJMVJDCUSZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |