C11H13N5O3 — CID 66237387
4-[methyl(7H-purin-6-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66237387) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-[methyl(7H-purin-6-yl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[methyl(7H-purin-6-yl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66237387 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-[methyl(7H-purin-6-yl)amino]oxolane-3-carboxylic acid |
| SMILES | CN(c1ncnc2nc[nH]c12)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H13N5O3/c1-16(7-3-19-2-6(7)11(17)18)10-8-9(13-4-12-8)14-5-15-10/h4-7H,2-3H2,1H3,(H,17,18)(H,12,13,14,15) |
| InChIKey | CYMAFLBUFXPCFH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |