About 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid
4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid (PubChem CID 66236176) has the molecular formula C8H11N3O3S
and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid.
Analyze 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid (CID 66236176) is 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid is CN(c1nncs1)C1COCC1C(=O)O.
What is the InChIKey of 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid?
The InChIKey is ZMGJLDAEEWNHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c1-11(8-10-9-4-15-8)6-3-14-2-5(6)7(12)13/h4-6H,2-3H2,1H3,(H,12,13).
What are the key properties of 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid?
4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid has a molecular weight of 229.26 g/mol, XLogP of 0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(1,3,4-thiadiazol-2-yl)amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 66236176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).