C13H19NO3S — CID 66237650
4-[(5-ethylthiophen-2-yl)methyl-methylamino]oxolane-3-carboxylic acid (PubChem CID 66237650) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(5-ethylthiophen-2-yl)methyl-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(5-ethylthiophen-2-yl)methyl-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66237650 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(5-ethylthiophen-2-yl)methyl-methylamino]oxolane-3-carboxylic acid |
| SMILES | CCc1ccc(CN(C)C2COCC2C(=O)O)s1 |
| InChI | InChI=1S/C13H19NO3S/c1-3-9-4-5-10(18-9)6-14(2)12-8-17-7-11(12)13(15)16/h4-5,11-12H,3,6-8H2,1-2H3,(H,15,16) |
| InChIKey | MQSVAJGEPLCHCL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |