C14H17F2NO4 — CID 66266684
4-[[4-(difluoromethoxy)phenyl]methyl-methylamino]oxolane-3-carboxylic acid (PubChem CID 66266684) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)phenyl]methyl-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[4-(difluoromethoxy)phenyl]methyl-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66266684 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-[[4-(difluoromethoxy)phenyl]methyl-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-17(12-8-20-7-11(12)13(18)19)6-9-2-4-10(5-3-9)21-14(15)16/h2-5,11-12,14H,6-8H2,1H3,(H,18,19) |
| InChIKey | WOCYXDVWWRFTRZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |