C12H10N6O — CID 19027373
1-phenyl-1-(7H-purin-6-yl)urea (PubChem CID 19027373) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-phenyl-1-(7H-purin-6-yl)urea.
| Compound Name | 1-phenyl-1-(7H-purin-6-yl)urea |
|---|---|
| PubChem CID | 19027373 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-phenyl-1-(7H-purin-6-yl)urea |
| SMILES | NC(=O)N(c1ccccc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10N6O/c13-12(19)18(8-4-2-1-3-5-8)11-9-10(15-6-14-9)16-7-17-11/h1-7H,(H2,13,19)(H,14,15,16,17) |
| InChIKey | NLVCUKSKFDUBST-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |