About N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine
N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine (PubChem CID 141038307) has the molecular formula C18H22N6OS
and a molecular weight of 370.48 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine |
| PubChem CID | 141038307 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine |
| SMILES | CN(CCOc1ccc(CC2CNCS2)cc1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C18H22N6OS/c1-24(18-16-17(21-10-20-16)22-11-23-18)6-7-25-14-4-2-13(3-5-14)8-15-9-19-12-26-15/h2-5,10-11,15,19H,6-9,12H2,1H3,(H,20,21,22,23) |
| InChIKey | LJGFJTWQJYEVGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine?
The IUPAC name of N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine (CID 141038307) is N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine.
What is the SMILES notation for N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine?
The canonical SMILES for N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine is CN(CCOc1ccc(CC2CNCS2)cc1)c1ncnc2nc[nH]c12.
What is the InChIKey of N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine?
The InChIKey is LJGFJTWQJYEVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6OS/c1-24(18-16-17(21-10-20-16)22-11-23-18)6-7-25-14-4-2-13(3-5-14)8-15-9-19-12-26-15/h2-5,10-11,15,19H,6-9,12H2,1H3,(H,20,21,22,23).
What are the key properties of N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine?
N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine has a molecular weight of 370.48 g/mol, XLogP of 2.07, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethyl]-7H-purin-6-amine is sourced from PubChem (CID 141038307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).