C16H17N7O — CID 39771137
N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-N-methyl-7H-purin-6-amine (PubChem CID 39771137) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-N-methyl-7H-purin-6-amine.
| Compound Name | N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-N-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 39771137 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]-N-methyl-7H-purin-6-amine |
| SMILES | COc1ccc2nc(CCN(C)c3ncnc4nc[nH]c34)[nH]c2c1 |
| InChI | InChI=1S/C16H17N7O/c1-23(16-14-15(18-8-17-14)19-9-20-16)6-5-13-21-11-4-3-10(24-2)7-12(11)22-13/h3-4,7-9H,5-6H2,1-2H3,(H,21,22)(H,17,18,19,20) |
| InChIKey | XXZVYUMEEAMIRR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |