C18H21N3O2S — CID 139712897
1-pyridin-4-yl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]methanimine (PubChem CID 139712897) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-pyridin-4-yl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]methanimine.
| Compound Name | 1-pyridin-4-yl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]methanimine |
|---|---|
| PubChem CID | 139712897 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-pyridin-4-yl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]methanimine |
| SMILES | C(=NOCCOc1ccc(CC2CNCS2)cc1)c1ccncc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-17(4-2-15(1)11-18-13-20-14-24-18)22-9-10-23-21-12-16-5-7-19-8-6-16/h1-8,12,18,20H,9-11,13-14H2 |
| InChIKey | QVUFZCZHXYBZGE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|