C22H26N2O4S — CID 139712877
[3-[C-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]carbonimidoyl]phenyl] acetate (PubChem CID 139712877) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [3-[C-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]carbonimidoyl]phenyl] acetate.
| Compound Name | [3-[C-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]carbonimidoyl]phenyl] acetate |
|---|---|
| PubChem CID | 139712877 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [3-[C-methyl-N-[2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]ethoxy]carbonimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(C)=NOCCOc2ccc(CC3CNCS3)cc2)c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-16(19-4-3-5-21(13-19)28-17(2)25)24-27-11-10-26-20-8-6-18(7-9-20)12-22-14-23-15-29-22/h3-9,13,22-23H,10-12,14-15H2,1-2H3 |
| InChIKey | RIRLEMGFASAFIX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|