C16H23NO3 — CID 67740923
[3-(3-piperidin-3-ylpropoxy)phenyl] acetate (PubChem CID 67740923) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [3-(3-piperidin-3-ylpropoxy)phenyl] acetate.
| Compound Name | [3-(3-piperidin-3-ylpropoxy)phenyl] acetate |
|---|---|
| PubChem CID | 67740923 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [3-(3-piperidin-3-ylpropoxy)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(OCCCC2CCCNC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-13(18)20-16-8-2-7-15(11-16)19-10-4-6-14-5-3-9-17-12-14/h2,7-8,11,14,17H,3-6,9-10,12H2,1H3 |
| InChIKey | UUPRFSKIQDKHQC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|