C24H33N3O2 — CID 69490917
(4-methylpiperazin-1-yl)-[6-(3-piperidin-3-ylpropoxy)naphthalen-2-yl]methanone (PubChem CID 69490917) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[6-(3-piperidin-3-ylpropoxy)naphthalen-2-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[6-(3-piperidin-3-ylpropoxy)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 69490917 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[6-(3-piperidin-3-ylpropoxy)naphthalen-2-yl]methanone |
| SMILES | CN1CCN(C(=O)c2ccc3cc(OCCCC4CCCNC4)ccc3c2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c1-26-11-13-27(14-12-26)24(28)22-7-6-21-17-23(9-8-20(21)16-22)29-15-3-5-19-4-2-10-25-18-19/h6-9,16-17,19,25H,2-5,10-15,18H2,1H3 |
| InChIKey | DORNWPMSLMBETI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|