C23H29N3O2 — CID 67011523
3,6-dihydro-2H-pyridin-1-yl-[6-(3-piperidin-3-ylpropoxy)quinolin-2-yl]methanone (PubChem CID 67011523) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl-[6-(3-piperidin-3-ylpropoxy)quinolin-2-yl]methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl-[6-(3-piperidin-3-ylpropoxy)quinolin-2-yl]methanone |
|---|---|
| PubChem CID | 67011523 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl-[6-(3-piperidin-3-ylpropoxy)quinolin-2-yl]methanone |
| SMILES | O=C(c1ccc2cc(OCCCC3CCCNC3)ccc2n1)N1CC=CCC1 |
| InChI | InChI=1S/C23H29N3O2/c27-23(26-13-2-1-3-14-26)22-10-8-19-16-20(9-11-21(19)25-22)28-15-5-7-18-6-4-12-24-17-18/h1-2,8-11,16,18,24H,3-7,12-15,17H2 |
| InChIKey | PTARSJUIGYHFCZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|