C22H29N3O4S — CID 11539264
(1,1-dioxo-1,4-thiazinan-4-yl)-[6-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone (PubChem CID 11539264) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[6-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[6-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone |
|---|---|
| PubChem CID | 11539264 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[6-(3-piperidin-1-ylpropoxy)quinolin-2-yl]methanone |
| SMILES | O=C(c1ccc2cc(OCCCN3CCCCC3)ccc2n1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C22H29N3O4S/c26-22(25-12-15-30(27,28)16-13-25)21-7-5-18-17-19(6-8-20(18)23-21)29-14-4-11-24-9-2-1-3-10-24/h5-8,17H,1-4,9-16H2 |
| InChIKey | CLUBJVKKZQRHSN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|