C22H28FN3O4 — CID 67317517
[6-(3-piperidin-1-ylpropoxy)quinolin-2-yl] N-[(3-fluorooxetan-3-yl)methyl]carbamate (PubChem CID 67317517) has the molecular formula C22H28FN3O4 and a molecular weight of 417.48 g/mol. Its IUPAC name is [6-(3-piperidin-1-ylpropoxy)quinolin-2-yl] N-[(3-fluorooxetan-3-yl)methyl]carbamate.
| Compound Name | [6-(3-piperidin-1-ylpropoxy)quinolin-2-yl] N-[(3-fluorooxetan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 67317517 |
| Molecular Formula | C22H28FN3O4 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [6-(3-piperidin-1-ylpropoxy)quinolin-2-yl] N-[(3-fluorooxetan-3-yl)methyl]carbamate |
| SMILES | O=C(NCC1(F)COC1)Oc1ccc2cc(OCCCN3CCCCC3)ccc2n1 |
| InChI | InChI=1S/C22H28FN3O4/c23-22(15-28-16-22)14-24-21(27)30-20-8-5-17-13-18(6-7-19(17)25-20)29-12-4-11-26-9-2-1-3-10-26/h5-8,13H,1-4,9-12,14-16H2,(H,24,27) |
| InChIKey | QIMJHPXPARNCDV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|