C20H26N4O3 — CID 151573426
N'-[2-(2-piperidin-1-ylethoxy)quinolin-6-yl]butanediamide (PubChem CID 151573426) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N'-[2-(2-piperidin-1-ylethoxy)quinolin-6-yl]butanediamide.
| Compound Name | N'-[2-(2-piperidin-1-ylethoxy)quinolin-6-yl]butanediamide |
|---|---|
| PubChem CID | 151573426 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N'-[2-(2-piperidin-1-ylethoxy)quinolin-6-yl]butanediamide |
| SMILES | NC(=O)CCC(=O)Nc1ccc2nc(OCCN3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C20H26N4O3/c21-18(25)7-8-19(26)22-16-5-6-17-15(14-16)4-9-20(23-17)27-13-12-24-10-2-1-3-11-24/h4-6,9,14H,1-3,7-8,10-13H2,(H2,21,25)(H,22,26) |
| InChIKey | QEYCGLNYXOQNIE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |