C34H46N6O2 — CID 10120705
N-[9-(cycloheptylamino)-6-(3-pyrrolidin-1-ylpropanoylamino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide (PubChem CID 10120705) has the molecular formula C34H46N6O2 and a molecular weight of 570.78 g/mol. Its IUPAC name is N-[9-(cycloheptylamino)-6-(3-pyrrolidin-1-ylpropanoylamino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide.
| Compound Name | N-[9-(cycloheptylamino)-6-(3-pyrrolidin-1-ylpropanoylamino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 10120705 |
| Molecular Formula | C34H46N6O2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | N-[9-(cycloheptylamino)-6-(3-pyrrolidin-1-ylpropanoylamino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCC1)Nc1ccc2c(NC3CCCCCC3)c3ccc(NC(=O)CCN4CCCC4)cc3nc2c1 |
| InChI | InChI=1S/C34H46N6O2/c41-32(15-21-39-17-5-6-18-39)35-26-11-13-28-30(23-26)38-31-24-27(36-33(42)16-22-40-19-7-8-20-40)12-14-29(31)34(28)37-25-9-3-1-2-4-10-25/h11-14,23-25H,1-10,15-22H2,(H,35,41)(H,36,42)(H,37,38) |
| InChIKey | YMXRYBNAQKQXFU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|