C45H61N9O4 — CID 10350345
N'-[4-[[3,6-bis(3-pyrrolidin-1-ylpropanoylamino)acridin-9-yl]amino]phenyl]-N-[2-(diethylamino)ethyl]hexanediamide (PubChem CID 10350345) has the molecular formula C45H61N9O4 and a molecular weight of 792.04 g/mol. Its IUPAC name is N'-[4-[[3,6-bis(3-pyrrolidin-1-ylpropanoylamino)acridin-9-yl]amino]phenyl]-N-[2-(diethylamino)ethyl]hexanediamide.
| Compound Name | N'-[4-[[3,6-bis(3-pyrrolidin-1-ylpropanoylamino)acridin-9-yl]amino]phenyl]-N-[2-(diethylamino)ethyl]hexanediamide |
|---|---|
| PubChem CID | 10350345 |
| Molecular Formula | C45H61N9O4 |
| Molecular Weight | 792.04 g/mol |
| Exact Mass | 791.48 |
| IUPAC Name | N'-[4-[[3,6-bis(3-pyrrolidin-1-ylpropanoylamino)acridin-9-yl]amino]phenyl]-N-[2-(diethylamino)ethyl]hexanediamide |
| SMILES | CCN(CC)CCNC(=O)CCCCC(=O)Nc1ccc(Nc2c3ccc(NC(=O)CCN4CCCC4)cc3nc3cc(NC(=O)CCN4CCCC4)ccc23)cc1 |
| InChI | InChI=1S/C45H61N9O4/c1-3-52(4-2)30-23-46-41(55)11-5-6-12-42(56)47-33-13-15-34(16-14-33)50-45-37-19-17-35(48-43(57)21-28-53-24-7-8-25-53)31-39(37)51-40-32-36(18-20-38(40)45)49-44(58)22-29-54-26-9-10-27-54/h13-20,31-32H,3-12,21-30H2,1-2H3,(H,46,55)(H,47,56)(H,48,57)(H,49,58)(H,50,51) |
| InChIKey | OHRRVGUOAWHKDN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.04 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|