C26H25BrN4O — CID 163184703
N-[9-(4-bromoanilino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide (PubChem CID 163184703) has the molecular formula C26H25BrN4O and a molecular weight of 489.42 g/mol. Its IUPAC name is N-[9-(4-bromoanilino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide.
| Compound Name | N-[9-(4-bromoanilino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide |
|---|---|
| PubChem CID | 163184703 |
| Molecular Formula | C26H25BrN4O |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-[9-(4-bromoanilino)acridin-3-yl]-3-pyrrolidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCC1)Nc1ccc2c(Nc3ccc(Br)cc3)c3ccccc3nc2c1 |
| InChI | InChI=1S/C26H25BrN4O/c27-18-7-9-19(10-8-18)29-26-21-5-1-2-6-23(21)30-24-17-20(11-12-22(24)26)28-25(32)13-16-31-14-3-4-15-31/h1-2,5-12,17H,3-4,13-16H2,(H,28,32)(H,29,30) |
| InChIKey | UNGAOAKJISVZGQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|