C19H29ClN4O2 — CID 110178520
N-[2-amino-6-(2-piperidin-1-ylethoxy)-3-pyridinyl]-4-chlorocyclohexane-1-carboxamide (PubChem CID 110178520) has the molecular formula C19H29ClN4O2 and a molecular weight of 380.92 g/mol. Its IUPAC name is N-[2-amino-6-(2-piperidin-1-ylethoxy)-3-pyridinyl]-4-chlorocyclohexane-1-carboxamide.
| Compound Name | N-[2-amino-6-(2-piperidin-1-ylethoxy)-3-pyridinyl]-4-chlorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 110178520 |
| Molecular Formula | C19H29ClN4O2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[2-amino-6-(2-piperidin-1-ylethoxy)-3-pyridinyl]-4-chlorocyclohexane-1-carboxamide |
| SMILES | Nc1nc(OCCN2CCCCC2)ccc1NC(=O)C1CCC(Cl)CC1 |
| InChI | InChI=1S/C19H29ClN4O2/c20-15-6-4-14(5-7-15)19(25)22-16-8-9-17(23-18(16)21)26-13-12-24-10-2-1-3-11-24/h8-9,14-15H,1-7,10-13H2,(H2,21,23)(H,22,25) |
| InChIKey | VLKPEGHICMYWJU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|