C20H32N4O3 — CID 66728866
methyl 4-[[5-amino-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexane-1-carboxylate (PubChem CID 66728866) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 4-[[5-amino-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[5-amino-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 66728866 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | methyl 4-[[5-amino-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Nc2cc(OCCN3CCCCC3)ncc2N)CC1 |
| InChI | InChI=1S/C20H32N4O3/c1-26-20(25)15-5-7-16(8-6-15)23-18-13-19(22-14-17(18)21)27-12-11-24-9-3-2-4-10-24/h13-16H,2-12,21H2,1H3,(H,22,23) |
| InChIKey | PJCTYWRCKNLQNJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |