C23H38N4O2 — CID 66728483
4-[2-amino-5-(2-piperidin-1-ylethoxy)anilino]-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 66728483) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-[2-amino-5-(2-piperidin-1-ylethoxy)anilino]-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[2-amino-5-(2-piperidin-1-ylethoxy)anilino]-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66728483 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 4-[2-amino-5-(2-piperidin-1-ylethoxy)anilino]-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCC(Nc2cc(OCCN3CCCCC3)ccc2N)CC1 |
| InChI | InChI=1S/C23H38N4O2/c1-17(2)25-23(28)18-6-8-19(9-7-18)26-22-16-20(10-11-21(22)24)29-15-14-27-12-4-3-5-13-27/h10-11,16-19,26H,3-9,12-15,24H2,1-2H3,(H,25,28) |
| InChIKey | GCKMSEICQBOJCL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|