C20H32N4O3S — CID 66728760
4-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 66728760) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66728760 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[2-amino-5-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCC(Nc2cc(N3CCS(=O)(=O)CC3)ccc2N)CC1 |
| InChI | InChI=1S/C20H32N4O3S/c1-14(2)22-20(25)15-3-5-16(6-4-15)23-19-13-17(7-8-18(19)21)24-9-11-28(26,27)12-10-24/h7-8,13-16,23H,3-6,9-12,21H2,1-2H3,(H,22,25) |
| InChIKey | IIROVMWJBFZTNG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|