C19H29N3O2 — CID 178129317
methyl 1-[4-amino-3-(cyclopentylamino)phenyl]-4-methylpiperidine-4-carboxylate (PubChem CID 178129317) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is methyl 1-[4-amino-3-(cyclopentylamino)phenyl]-4-methylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[4-amino-3-(cyclopentylamino)phenyl]-4-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 178129317 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | methyl 1-[4-amino-3-(cyclopentylamino)phenyl]-4-methylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(C)CCN(c2ccc(N)c(NC3CCCC3)c2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-19(18(23)24-2)9-11-22(12-10-19)15-7-8-16(20)17(13-15)21-14-5-3-4-6-14/h7-8,13-14,21H,3-6,9-12,20H2,1-2H3 |
| InChIKey | DWWLOBXUJUUWRH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|