C21H27N3O2 — CID 54434751
(3,4-diaminophenyl)-[3-(3-piperidin-3-ylpropoxy)phenyl]methanone (PubChem CID 54434751) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[3-(3-piperidin-3-ylpropoxy)phenyl]methanone.
| Compound Name | (3,4-diaminophenyl)-[3-(3-piperidin-3-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 54434751 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (3,4-diaminophenyl)-[3-(3-piperidin-3-ylpropoxy)phenyl]methanone |
| SMILES | Nc1ccc(C(=O)c2cccc(OCCCC3CCCNC3)c2)cc1N |
| InChI | InChI=1S/C21H27N3O2/c22-19-9-8-17(13-20(19)23)21(25)16-6-1-7-18(12-16)26-11-3-5-15-4-2-10-24-14-15/h1,6-9,12-13,15,24H,2-5,10-11,14,22-23H2 |
| InChIKey | WJYKYJRVKONHSJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|