C20H25N3O3 — CID 21451424
(3,4-diaminophenyl)-[3-(2-morpholin-2-ylpropoxy)phenyl]methanone (PubChem CID 21451424) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[3-(2-morpholin-2-ylpropoxy)phenyl]methanone.
| Compound Name | (3,4-diaminophenyl)-[3-(2-morpholin-2-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 21451424 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (3,4-diaminophenyl)-[3-(2-morpholin-2-ylpropoxy)phenyl]methanone |
| SMILES | CC(COc1cccc(C(=O)c2ccc(N)c(N)c2)c1)C1CNCCO1 |
| InChI | InChI=1S/C20H25N3O3/c1-13(19-11-23-7-8-25-19)12-26-16-4-2-3-14(9-16)20(24)15-5-6-17(21)18(22)10-15/h2-6,9-10,13,19,23H,7-8,11-12,21-22H2,1H3 |
| InChIKey | VTYQGFYUUARMRZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|