C45H38N2O4S — CID 86751802
5-[[4-[2-[1-(3-phenylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione (PubChem CID 86751802) has the molecular formula C45H38N2O4S and a molecular weight of 702.88 g/mol. Its IUPAC name is 5-[[4-[2-[1-(3-phenylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[1-(3-phenylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 86751802 |
| Molecular Formula | C45H38N2O4S |
| Molecular Weight | 702.88 g/mol |
| Exact Mass | 702.26 |
| IUPAC Name | 5-[[4-[2-[1-(3-phenylphenyl)ethylideneamino]oxyethoxy]phenyl]methyl]-3-trityl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=NOCCOc1ccc(CC2SC(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C45H38N2O4S/c1-33(36-17-14-18-37(32-36)35-15-6-2-7-16-35)46-51-30-29-50-41-27-25-34(26-28-41)31-42-43(48)47(44(49)52-42)45(38-19-8-3-9-20-38,39-21-10-4-11-22-39)40-23-12-5-13-24-40/h2-28,32,42H,29-31H2,1H3 |
| InChIKey | RHEDXTSMXLNXOD-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.88 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|