C12H15NO2S — CID 139672060
2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]acetaldehyde (PubChem CID 139672060) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]acetaldehyde.
| Compound Name | 2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 139672060 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-[4-(1,3-thiazolidin-5-ylmethyl)phenoxy]acetaldehyde |
| SMILES | O=CCOc1ccc(CC2CNCS2)cc1 |
| InChI | InChI=1S/C12H15NO2S/c14-5-6-15-11-3-1-10(2-4-11)7-12-8-13-9-16-12/h1-5,12-13H,6-9H2 |
| InChIKey | JICNHVYKNXYEGV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|