About 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine
2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine (PubChem CID 113442687) has the molecular formula C13H18ClN5
and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine |
| PubChem CID | 113442687 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine |
| SMILES | CC1CCC(Nc2nc(Cl)nc3nc[nH]c23)CC1C |
| InChI | InChI=1S/C13H18ClN5/c1-7-3-4-9(5-8(7)2)17-12-10-11(16-6-15-10)18-13(14)19-12/h6-9H,3-5H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | RQXRQJIMTXFMPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine?
The IUPAC name of 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine (CID 113442687) is 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine.
What is the SMILES notation for 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine?
The canonical SMILES for 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine is CC1CCC(Nc2nc(Cl)nc3nc[nH]c23)CC1C.
What is the InChIKey of 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine?
The InChIKey is RQXRQJIMTXFMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN5/c1-7-3-4-9(5-8(7)2)17-12-10-11(16-6-15-10)18-13(14)19-12/h6-9H,3-5H2,1-2H3,(H2,15,16,17,18,19).
What are the key properties of 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine?
2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine has a molecular weight of 279.77 g/mol, XLogP of 3.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine is sourced from PubChem (CID 113442687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).