C13H18ClN5 — CID 113442687
2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine (PubChem CID 113442687) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine.
| Compound Name | 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 113442687 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-chloro-N-(3,4-dimethylcyclohexyl)-7H-purin-6-amine |
| SMILES | CC1CCC(Nc2nc(Cl)nc3nc[nH]c23)CC1C |
| InChI | InChI=1S/C13H18ClN5/c1-7-3-4-9(5-8(7)2)17-12-10-11(16-6-15-10)18-13(14)19-12/h6-9H,3-5H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | RQXRQJIMTXFMPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |