C10H10Cl2N5+ — CID 86177835
4,6-dichloro-N-(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazin-2-amine (PubChem CID 86177835) has the molecular formula C10H10Cl2N5+ and a molecular weight of 271.13 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 86177835 |
| Molecular Formula | C10H10Cl2N5+ |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 4,6-dichloro-N-(2-pyridin-1-ium-1-ylethyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NCC[n+]2ccccc2)n1 |
| InChI | InChI=1S/C10H10Cl2N5/c11-8-14-9(12)16-10(15-8)13-4-7-17-5-2-1-3-6-17/h1-3,5-6H,4,7H2,(H,13,14,15,16)/q+1 |
| InChIKey | IFDWTUSNTPVKBN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|