C14H20ClN3O2 — CID 162360082
methyl 2-[1-[(2-chloro-5-methylpyrimidin-4-yl)amino]cyclohexyl]acetate (PubChem CID 162360082) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is methyl 2-[1-[(2-chloro-5-methylpyrimidin-4-yl)amino]cyclohexyl]acetate.
| Compound Name | methyl 2-[1-[(2-chloro-5-methylpyrimidin-4-yl)amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 162360082 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 2-[1-[(2-chloro-5-methylpyrimidin-4-yl)amino]cyclohexyl]acetate |
| SMILES | COC(=O)CC1(Nc2nc(Cl)ncc2C)CCCCC1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-10-9-16-13(15)17-12(10)18-14(8-11(19)20-2)6-4-3-5-7-14/h9H,3-8H2,1-2H3,(H,16,17,18) |
| InChIKey | HCNFAUBYDVPNNA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |